C31H39N5O2 — CID 123809976
8-ethyl-6-[2-methyl-4-[4-methyl-2-(propylideneamino)hexa-1,3-dien-3-yl]phenyl]-2-(oxan-4-ylamino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 123809976) has the molecular formula C31H39N5O2 and a molecular weight of 513.69 g/mol. Its IUPAC name is 8-ethyl-6-[2-methyl-4-[4-methyl-2-(propylideneamino)hexa-1,3-dien-3-yl]phenyl]-2-(oxan-4-ylamino)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-ethyl-6-[2-methyl-4-[4-methyl-2-(propylideneamino)hexa-1,3-dien-3-yl]phenyl]-2-(oxan-4-ylamino)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 123809976 |
| Molecular Formula | C31H39N5O2 |
| Molecular Weight | 513.69 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | 8-ethyl-6-[2-methyl-4-[4-methyl-2-(propylideneamino)hexa-1,3-dien-3-yl]phenyl]-2-(oxan-4-ylamino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C=C(/N=C/CC)C(=C(C)CC)c1ccc(-c2cc3cnc(NC4CCOCC4)nc3n(CC)c2=O)c(C)c1 |
| InChI | InChI=1S/C31H39N5O2/c1-7-14-32-22(6)28(20(4)8-2)23-10-11-26(21(5)17-23)27-18-24-19-33-31(34-25-12-15-38-16-13-25)35-29(24)36(9-3)30(27)37/h10-11,14,17-19,25H,6-9,12-13,15-16H2,1-5H3,(H,33,34,35)/b28-20?,32-14+ |
| InChIKey | ZXQNVZVQHLSJAS-IBPQRYTLSA-N |
| XLogP | 6.56 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.69 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|