C28H33N5O2 — CID 143271670
2-(1,2,3,3a,4,5,6,6a-octahydropentalen-2-ylamino)-6-(2-methylphenyl)-8-(2-oxo-2-pyrrolidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 143271670) has the molecular formula C28H33N5O2 and a molecular weight of 471.61 g/mol. Its IUPAC name is 2-(1,2,3,3a,4,5,6,6a-octahydropentalen-2-ylamino)-6-(2-methylphenyl)-8-(2-oxo-2-pyrrolidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-(1,2,3,3a,4,5,6,6a-octahydropentalen-2-ylamino)-6-(2-methylphenyl)-8-(2-oxo-2-pyrrolidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 143271670 |
| Molecular Formula | C28H33N5O2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 2-(1,2,3,3a,4,5,6,6a-octahydropentalen-2-ylamino)-6-(2-methylphenyl)-8-(2-oxo-2-pyrrolidin-1-ylethyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1ccccc1-c1cc2cnc(NC3CC4CCCC4C3)nc2n(CC(=O)N2CCCC2)c1=O |
| InChI | InChI=1S/C28H33N5O2/c1-18-7-2-3-10-23(18)24-15-21-16-29-28(30-22-13-19-8-6-9-20(19)14-22)31-26(21)33(27(24)35)17-25(34)32-11-4-5-12-32/h2-3,7,10,15-16,19-20,22H,4-6,8-9,11-14,17H2,1H3,(H,29,30,31) |
| InChIKey | PVYPUKNWKXXNMX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |