C21H24N4O3 — CID 59913222
2-[(4,4-dihydroxycyclohexyl)amino]-8-methyl-6-(2-methylphenyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 59913222) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 2-[(4,4-dihydroxycyclohexyl)amino]-8-methyl-6-(2-methylphenyl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[(4,4-dihydroxycyclohexyl)amino]-8-methyl-6-(2-methylphenyl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 59913222 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 2-[(4,4-dihydroxycyclohexyl)amino]-8-methyl-6-(2-methylphenyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1ccccc1-c1cc2cnc(NC3CCC(O)(O)CC3)nc2n(C)c1=O |
| InChI | InChI=1S/C21H24N4O3/c1-13-5-3-4-6-16(13)17-11-14-12-22-20(24-18(14)25(2)19(17)26)23-15-7-9-21(27,28)10-8-15/h3-6,11-12,15,27-28H,7-10H2,1-2H3,(H,22,23,24) |
| InChIKey | OBBLDLTXTDNIAQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|