C28H38N6O2 — CID 143271671
N-[2-[2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylamino)-6-(2-methylphenyl)-7-oxopyrido[2,3-d]pyrimidin-8-yl]ethyl]propanamide;ethane (PubChem CID 143271671) has the molecular formula C28H38N6O2 and a molecular weight of 490.65 g/mol. Its IUPAC name is N-[2-[2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylamino)-6-(2-methylphenyl)-7-oxopyrido[2,3-d]pyrimidin-8-yl]ethyl]propanamide;ethane.
| Compound Name | N-[2-[2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylamino)-6-(2-methylphenyl)-7-oxopyrido[2,3-d]pyrimidin-8-yl]ethyl]propanamide;ethane |
|---|---|
| PubChem CID | 143271671 |
| Molecular Formula | C28H38N6O2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | N-[2-[2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylamino)-6-(2-methylphenyl)-7-oxopyrido[2,3-d]pyrimidin-8-yl]ethyl]propanamide;ethane |
| SMILES | CC.CCC(=O)NCCn1c(=O)c(-c2ccccc2C)cc2cnc(NN3CC4CCCC4C3)nc21 |
| InChI | InChI=1S/C26H32N6O2.C2H6/c1-3-23(33)27-11-12-32-24-20(13-22(25(32)34)21-10-5-4-7-17(21)2)14-28-26(29-24)30-31-15-18-8-6-9-19(18)16-31;1-2/h4-5,7,10,13-14,18-19H,3,6,8-9,11-12,15-16H2,1-2H3,(H,27,33)(H,28,29,30);1-2H3 |
| InChIKey | MXACFHGARDEPTH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |