C21H20N2O4 — CID 123810304
4-[4-[(6-ethyl-3-hydroxy-4-oxopyran-2-yl)methylamino]phenyl]benzamide (PubChem CID 123810304) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is 4-[4-[(6-ethyl-3-hydroxy-4-oxopyran-2-yl)methylamino]phenyl]benzamide.
| Compound Name | 4-[4-[(6-ethyl-3-hydroxy-4-oxopyran-2-yl)methylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 123810304 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 4-[4-[(6-ethyl-3-hydroxy-4-oxopyran-2-yl)methylamino]phenyl]benzamide |
| SMILES | CCc1cc(=O)c(O)c(CNc2ccc(-c3ccc(C(N)=O)cc3)cc2)o1 |
| InChI | InChI=1S/C21H20N2O4/c1-2-17-11-18(24)20(25)19(27-17)12-23-16-9-7-14(8-10-16)13-3-5-15(6-4-13)21(22)26/h3-11,23,25H,2,12H2,1H3,(H2,22,26) |
| InChIKey | HVGOAXJCHBISRR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |