C19H18ClN7O — CID 123810369
6-[[6-chloro-2-(1-methylpyrazol-4-yl)-1H-imidazo[4,5-b]pyridin-7-yl]amino]-2-ethynylcyclohex-3-ene-1-carboxamide (PubChem CID 123810369) has the molecular formula C19H18ClN7O and a molecular weight of 395.85 g/mol. Its IUPAC name is 6-[[6-chloro-2-(1-methylpyrazol-4-yl)-1H-imidazo[4,5-b]pyridin-7-yl]amino]-2-ethynylcyclohex-3-ene-1-carboxamide.
| Compound Name | 6-[[6-chloro-2-(1-methylpyrazol-4-yl)-1H-imidazo[4,5-b]pyridin-7-yl]amino]-2-ethynylcyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 123810369 |
| Molecular Formula | C19H18ClN7O |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 6-[[6-chloro-2-(1-methylpyrazol-4-yl)-1H-imidazo[4,5-b]pyridin-7-yl]amino]-2-ethynylcyclohex-3-ene-1-carboxamide |
| SMILES | C#CC1C=CCC(Nc2c(Cl)cnc3nc(-c4cnn(C)c4)[nH]c23)C1C(N)=O |
| InChI | InChI=1S/C19H18ClN7O/c1-3-10-5-4-6-13(14(10)17(21)28)24-15-12(20)8-22-19-16(15)25-18(26-19)11-7-23-27(2)9-11/h1,4-5,7-10,13-14H,6H2,2H3,(H2,21,28)(H2,22,24,25,26) |
| InChIKey | CDAVSPPQAQZCKE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|