C25H20ClFN4O2S2 — CID 123811370
2-(2-chlorophenyl)sulfanyl-5-[6-[(6-fluoro-3-pyridinyl)amino]-2-pyridinyl]-3-oxo-5-thiophen-3-ylpentanamide (PubChem CID 123811370) has the molecular formula C25H20ClFN4O2S2 and a molecular weight of 527.05 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-5-[6-[(6-fluoro-3-pyridinyl)amino]-2-pyridinyl]-3-oxo-5-thiophen-3-ylpentanamide.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-5-[6-[(6-fluoro-3-pyridinyl)amino]-2-pyridinyl]-3-oxo-5-thiophen-3-ylpentanamide |
|---|---|
| PubChem CID | 123811370 |
| Molecular Formula | C25H20ClFN4O2S2 |
| Molecular Weight | 527.05 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-5-[6-[(6-fluoro-3-pyridinyl)amino]-2-pyridinyl]-3-oxo-5-thiophen-3-ylpentanamide |
| SMILES | NC(=O)C(Sc1ccccc1Cl)C(=O)CC(c1ccsc1)c1cccc(Nc2ccc(F)nc2)n1 |
| InChI | InChI=1S/C25H20ClFN4O2S2/c26-18-4-1-2-6-21(18)35-24(25(28)33)20(32)12-17(15-10-11-34-14-15)19-5-3-7-23(31-19)30-16-8-9-22(27)29-13-16/h1-11,13-14,17,24H,12H2,(H2,28,33)(H,30,31) |
| InChIKey | PAASNNWIPSSKEM-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.05 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|