C13H17FNO- — CID 123811801
3-[(4-fluorophenoxy)methyl]-1-methanidylpiperidine (PubChem CID 123811801) has the molecular formula C13H17FNO- and a molecular weight of 222.28 g/mol. Its IUPAC name is 3-[(4-fluorophenoxy)methyl]-1-methanidylpiperidine.
| Compound Name | 3-[(4-fluorophenoxy)methyl]-1-methanidylpiperidine |
|---|---|
| PubChem CID | 123811801 |
| Molecular Formula | C13H17FNO- |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 3-[(4-fluorophenoxy)methyl]-1-methanidylpiperidine |
| SMILES | [CH2-]N1CCCC(COc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C13H17FNO/c1-15-8-2-3-11(9-15)10-16-13-6-4-12(14)5-7-13/h4-7,11H,1-3,8-10H2/q-1 |
| InChIKey | FPQWCERNKYDMRZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|