C14H18ClN3O — CID 123812806
3-(4-chlorophenyl)-N,N-dipropyl-1,2,4-oxadiazol-5-amine (PubChem CID 123812806) has the molecular formula C14H18ClN3O and a molecular weight of 279.77 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N,N-dipropyl-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(4-chlorophenyl)-N,N-dipropyl-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 123812806 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 3-(4-chlorophenyl)-N,N-dipropyl-1,2,4-oxadiazol-5-amine |
| SMILES | CCCN(CCC)c1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C14H18ClN3O/c1-3-9-18(10-4-2)14-16-13(17-19-14)11-5-7-12(15)8-6-11/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | BZICOMUOQLCCJA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |