C15H17BrN2S — CID 123813619
4-(2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2,6-dimethylaniline (PubChem CID 123813619) has the molecular formula C15H17BrN2S and a molecular weight of 337.29 g/mol. Its IUPAC name is 4-(2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2,6-dimethylaniline.
| Compound Name | 4-(2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2,6-dimethylaniline |
|---|---|
| PubChem CID | 123813619 |
| Molecular Formula | C15H17BrN2S |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 4-(2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2,6-dimethylaniline |
| SMILES | Cc1cc(N2CCc3sc(Br)cc3C2)cc(C)c1N |
| InChI | InChI=1S/C15H17BrN2S/c1-9-5-12(6-10(2)15(9)17)18-4-3-13-11(8-18)7-14(16)19-13/h5-7H,3-4,8,17H2,1-2H3 |
| InChIKey | GRAZWIXTGFDIGG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|