C26H23NO3 — CID 123814607
2-(4-methylphenyl)-2-[3-(3-methylphenyl)-1-oxoisoquinolin-2-yl]propanoic acid (PubChem CID 123814607) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is 2-(4-methylphenyl)-2-[3-(3-methylphenyl)-1-oxoisoquinolin-2-yl]propanoic acid.
| Compound Name | 2-(4-methylphenyl)-2-[3-(3-methylphenyl)-1-oxoisoquinolin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 123814607 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 2-(4-methylphenyl)-2-[3-(3-methylphenyl)-1-oxoisoquinolin-2-yl]propanoic acid |
| SMILES | Cc1ccc(C(C)(C(=O)O)n2c(-c3cccc(C)c3)cc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C26H23NO3/c1-17-11-13-21(14-12-17)26(3,25(29)30)27-23(20-9-6-7-18(2)15-20)16-19-8-4-5-10-22(19)24(27)28/h4-16H,1-3H3,(H,29,30) |
| InChIKey | XYBGYTQOHKZCAP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |