C32H36N+ — CID 123815382
1-[9,9-dimethyl-3-(3-methylpentan-3-yl)fluoren-2-yl]-2-ethylisoquinolin-2-ium (PubChem CID 123815382) has the molecular formula C32H36N+ and a molecular weight of 434.65 g/mol. Its IUPAC name is 1-[9,9-dimethyl-3-(3-methylpentan-3-yl)fluoren-2-yl]-2-ethylisoquinolin-2-ium.
| Compound Name | 1-[9,9-dimethyl-3-(3-methylpentan-3-yl)fluoren-2-yl]-2-ethylisoquinolin-2-ium |
|---|---|
| PubChem CID | 123815382 |
| Molecular Formula | C32H36N+ |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 1-[9,9-dimethyl-3-(3-methylpentan-3-yl)fluoren-2-yl]-2-ethylisoquinolin-2-ium |
| SMILES | CC[n+]1ccc2ccccc2c1-c1cc2c(cc1C(C)(CC)CC)-c1ccccc1C2(C)C |
| InChI | InChI=1S/C32H36N/c1-7-32(6,8-2)29-20-25-24-16-12-13-17-27(24)31(4,5)28(25)21-26(29)30-23-15-11-10-14-22(23)18-19-33(30)9-3/h10-21H,7-9H2,1-6H3/q+1 |
| InChIKey | IJABHHHYNXCMSY-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|