C27H22N3+ — CID 160735847
5,5,27-trimethyl-1,15-diaza-26-azoniaheptacyclo[14.11.0.02,14.04,12.06,11.017,26.018,23]heptacosa-2(14),3,6,8,10,12,15,17(26),18,20,22,24-dodecaene (PubChem CID 160735847) has the molecular formula C27H22N3+ and a molecular weight of 388.49 g/mol. Its IUPAC name is 5,5,27-trimethyl-1,15-diaza-26-azoniaheptacyclo[14.11.0.02,14.04,12.06,11.017,26.018,23]heptacosa-2(14),3,6,8,10,12,15,17(26),18,20,22,24-dodecaene.
| Compound Name | 5,5,27-trimethyl-1,15-diaza-26-azoniaheptacyclo[14.11.0.02,14.04,12.06,11.017,26.018,23]heptacosa-2(14),3,6,8,10,12,15,17(26),18,20,22,24-dodecaene |
|---|---|
| PubChem CID | 160735847 |
| Molecular Formula | C27H22N3+ |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 5,5,27-trimethyl-1,15-diaza-26-azoniaheptacyclo[14.11.0.02,14.04,12.06,11.017,26.018,23]heptacosa-2(14),3,6,8,10,12,15,17(26),18,20,22,24-dodecaene |
| SMILES | CC1n2c(nc3cc4c(cc32)C(C)(C)c2ccccc2-4)-c2c3ccccc3cc[n+]21 |
| InChI | InChI=1S/C27H22N3/c1-16-29-13-12-17-8-4-5-9-18(17)25(29)26-28-23-14-20-19-10-6-7-11-21(19)27(2,3)22(20)15-24(23)30(16)26/h4-16H,1-3H3/q+1 |
| InChIKey | KNNWXHLAFANTMU-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|