C23H20N3+ — CID 158918560
10,10,15-trimethyl-14,23-diaza-16-azoniahexacyclo[11.10.0.03,11.04,9.014,22.016,21]tricosa-1(13),2,4,6,8,11,16,18,20,22-decaene (PubChem CID 158918560) has the molecular formula C23H20N3+ and a molecular weight of 338.43 g/mol. Its IUPAC name is 10,10,15-trimethyl-14,23-diaza-16-azoniahexacyclo[11.10.0.03,11.04,9.014,22.016,21]tricosa-1(13),2,4,6,8,11,16,18,20,22-decaene.
| Compound Name | 10,10,15-trimethyl-14,23-diaza-16-azoniahexacyclo[11.10.0.03,11.04,9.014,22.016,21]tricosa-1(13),2,4,6,8,11,16,18,20,22-decaene |
|---|---|
| PubChem CID | 158918560 |
| Molecular Formula | C23H20N3+ |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 10,10,15-trimethyl-14,23-diaza-16-azoniahexacyclo[11.10.0.03,11.04,9.014,22.016,21]tricosa-1(13),2,4,6,8,11,16,18,20,22-decaene |
| SMILES | CC1n2c(nc3cc4c(cc32)C(C)(C)c2ccccc2-4)-c2cccc[n+]21 |
| InChI | InChI=1S/C23H20N3/c1-14-25-11-7-6-10-20(25)22-24-19-12-16-15-8-4-5-9-17(15)23(2,3)18(16)13-21(19)26(14)22/h4-14H,1-3H3/q+1 |
| InChIKey | DLHQFDDGYWTGQS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|