C22H36FNO — CID 123815567
4-fluoro-N-[5-methyl-2,2-bis(2-methylpropyl)hexyl]benzamide (PubChem CID 123815567) has the molecular formula C22H36FNO and a molecular weight of 349.53 g/mol. Its IUPAC name is 4-fluoro-N-[5-methyl-2,2-bis(2-methylpropyl)hexyl]benzamide.
| Compound Name | 4-fluoro-N-[5-methyl-2,2-bis(2-methylpropyl)hexyl]benzamide |
|---|---|
| PubChem CID | 123815567 |
| Molecular Formula | C22H36FNO |
| Molecular Weight | 349.53 g/mol |
| Exact Mass | 349.28 |
| IUPAC Name | 4-fluoro-N-[5-methyl-2,2-bis(2-methylpropyl)hexyl]benzamide |
| SMILES | CC(C)CCC(CNC(=O)c1ccc(F)cc1)(CC(C)C)CC(C)C |
| InChI | InChI=1S/C22H36FNO/c1-16(2)11-12-22(13-17(3)4,14-18(5)6)15-24-21(25)19-7-9-20(23)10-8-19/h7-10,16-18H,11-15H2,1-6H3,(H,24,25) |
| InChIKey | GJWUDCXDJNWFHA-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.53 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |