C45H82O10 — CID 123816066
19-[1,2-dihydroxy-1-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethyl]-19-hydroxyheptatriaconta-9,28-diene-18,20-dione (PubChem CID 123816066) has the molecular formula C45H82O10 and a molecular weight of 783.14 g/mol. Its IUPAC name is 19-[1,2-dihydroxy-1-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethyl]-19-hydroxyheptatriaconta-9,28-diene-18,20-dione.
| Compound Name | 19-[1,2-dihydroxy-1-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethyl]-19-hydroxyheptatriaconta-9,28-diene-18,20-dione |
|---|---|
| PubChem CID | 123816066 |
| Molecular Formula | C45H82O10 |
| Molecular Weight | 783.14 g/mol |
| Exact Mass | 782.59 |
| IUPAC Name | 19-[1,2-dihydroxy-1-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethyl]-19-hydroxyheptatriaconta-9,28-diene-18,20-dione |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)C(O)(C(=O)CCCCCCCC=CCCCCCCCC)C(O)(CO)C1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C45H82O10/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(48)45(54,44(53,36-47)43-42(52)41(51)40(50)37(35-46)55-43)39(49)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,37,40-43,46-47,50-54H,3-16,21-36H2,1-2H3/t37-,40-,41+,42-,43?,44?,45?/m1/s1 |
| InChIKey | PNYGUSVYGNONTI-XZYKSMGRSA-N |
| XLogP | 7.50 |
| TPSA | 184.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.14 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|