C10H16O — CID 123816222
4-penta-2,4-dien-2-yloxane (PubChem CID 123816222) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is 4-penta-2,4-dien-2-yloxane.
| Compound Name | 4-penta-2,4-dien-2-yloxane |
|---|---|
| PubChem CID | 123816222 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 4-penta-2,4-dien-2-yloxane |
| SMILES | C=CC=C(C)C1CCOCC1 |
| InChI | InChI=1S/C10H16O/c1-3-4-9(2)10-5-7-11-8-6-10/h3-4,10H,1,5-8H2,2H3 |
| InChIKey | WRQVYYCRPCQXGN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|