C17H27FO — CID 143270762
4-[(2E,4Z,6Z)-5,6-diethyl-2-fluoroocta-2,4,6-trien-3-yl]oxane (PubChem CID 143270762) has the molecular formula C17H27FO and a molecular weight of 266.40 g/mol. Its IUPAC name is 4-[(2E,4Z,6Z)-5,6-diethyl-2-fluoroocta-2,4,6-trien-3-yl]oxane.
| Compound Name | 4-[(2E,4Z,6Z)-5,6-diethyl-2-fluoroocta-2,4,6-trien-3-yl]oxane |
|---|---|
| PubChem CID | 143270762 |
| Molecular Formula | C17H27FO |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 4-[(2E,4Z,6Z)-5,6-diethyl-2-fluoroocta-2,4,6-trien-3-yl]oxane |
| SMILES | C/C=C(CC)\C(=C/C(=C(\C)F)C1CCOCC1)CC |
| InChI | InChI=1S/C17H27FO/c1-5-14(6-2)15(7-3)12-17(13(4)18)16-8-10-19-11-9-16/h5,12,16H,6-11H2,1-4H3/b14-5-,15-12-,17-13- |
| InChIKey | BICGDZZTAVYHLL-STGYSXIXSA-N |
| XLogP | 5.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|