C15H23FO — CID 142961165
3-fluoro-5-methyl-2-(2-methylidene-4-propoxybutyl)cyclohexa-1,3-diene (PubChem CID 142961165) has the molecular formula C15H23FO and a molecular weight of 238.35 g/mol. Its IUPAC name is 3-fluoro-5-methyl-2-(2-methylidene-4-propoxybutyl)cyclohexa-1,3-diene.
| Compound Name | 3-fluoro-5-methyl-2-(2-methylidene-4-propoxybutyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142961165 |
| Molecular Formula | C15H23FO |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 3-fluoro-5-methyl-2-(2-methylidene-4-propoxybutyl)cyclohexa-1,3-diene |
| SMILES | C=C(CCOCCC)CC1=CCC(C)C=C1F |
| InChI | InChI=1S/C15H23FO/c1-4-8-17-9-7-13(3)10-14-6-5-12(2)11-15(14)16/h6,11-12H,3-5,7-10H2,1-2H3 |
| InChIKey | XXWYNZVHZQOMPO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|