C15H27FO — CID 91170622
1-fluoro-9-methoxy-2,8-dimethyl-5-propan-2-ylnona-2,4-diene (PubChem CID 91170622) has the molecular formula C15H27FO and a molecular weight of 242.38 g/mol. Its IUPAC name is 1-fluoro-9-methoxy-2,8-dimethyl-5-propan-2-ylnona-2,4-diene.
| Compound Name | 1-fluoro-9-methoxy-2,8-dimethyl-5-propan-2-ylnona-2,4-diene |
|---|---|
| PubChem CID | 91170622 |
| Molecular Formula | C15H27FO |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1-fluoro-9-methoxy-2,8-dimethyl-5-propan-2-ylnona-2,4-diene |
| SMILES | COCC(C)CCC(=CC=C(C)CF)C(C)C |
| InChI | InChI=1S/C15H27FO/c1-12(2)15(8-6-13(3)10-16)9-7-14(4)11-17-5/h6,8,12,14H,7,9-11H2,1-5H3 |
| InChIKey | AXCLVLAYGZDHJR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|