C15H21N3O3 — CID 123817835
cis-ethyl (1S,3R)-3-[4-(N'-hydroxycarbamimidoyl)anilino]cyclopentane-1-carboxylate (PubChem CID 123817835) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is cis-ethyl (1S,3R)-3-[4-(N'-hydroxycarbamimidoyl)anilino]cyclopentane-1-carboxylate.
| Compound Name | cis-ethyl (1S,3R)-3-[4-(N'-hydroxycarbamimidoyl)anilino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 123817835 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | cis-ethyl (1S,3R)-3-[4-(N'-hydroxycarbamimidoyl)anilino]cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC[C@@H](Nc2ccc(C(N)=NO)cc2)C1 |
| InChI | InChI=1S/C15H21N3O3/c1-2-21-15(19)11-5-8-13(9-11)17-12-6-3-10(4-7-12)14(16)18-20/h3-4,6-7,11,13,17,20H,2,5,8-9H2,1H3,(H2,16,18)/t11-,13+/m0/s1 |
| InChIKey | ROEGCCATJNZPFL-WCQYABFASA-N |
| XLogP | 1.92 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|