C15H20ClN3O2 — CID 133420616
ethyl 3-[(6-chloro-2-cyclopropylpyrimidin-4-yl)amino]cyclopentane-1-carboxylate (PubChem CID 133420616) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is ethyl 3-[(6-chloro-2-cyclopropylpyrimidin-4-yl)amino]cyclopentane-1-carboxylate.
| Compound Name | ethyl 3-[(6-chloro-2-cyclopropylpyrimidin-4-yl)amino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 133420616 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | ethyl 3-[(6-chloro-2-cyclopropylpyrimidin-4-yl)amino]cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(Nc2cc(Cl)nc(C3CC3)n2)C1 |
| InChI | InChI=1S/C15H20ClN3O2/c1-2-21-15(20)10-5-6-11(7-10)17-13-8-12(16)18-14(19-13)9-3-4-9/h8-11H,2-7H2,1H3,(H,17,18,19) |
| InChIKey | JCLFNMDNMMRVSZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |