C11H21N3 — CID 123820104
8-methyl-2-propan-2-yl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine (PubChem CID 123820104) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 8-methyl-2-propan-2-yl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine.
| Compound Name | 8-methyl-2-propan-2-yl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 123820104 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 8-methyl-2-propan-2-yl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine |
| SMILES | CC1CCN2CCC(C(C)C)N=C2N1 |
| InChI | InChI=1S/C11H21N3/c1-8(2)10-5-7-14-6-4-9(3)12-11(14)13-10/h8-10H,4-7H2,1-3H3,(H,12,13) |
| InChIKey | BYPBYNJYUBTMLE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |