C8H11ClF3N — CID 123820732
(Z)-2-(chloromethyl)-1,1,1-trifluorohept-2-en-4-imine (PubChem CID 123820732) has the molecular formula C8H11ClF3N and a molecular weight of 213.63 g/mol. Its IUPAC name is (Z)-2-(chloromethyl)-1,1,1-trifluorohept-2-en-4-imine.
| Compound Name | (Z)-2-(chloromethyl)-1,1,1-trifluorohept-2-en-4-imine |
|---|---|
| PubChem CID | 123820732 |
| Molecular Formula | C8H11ClF3N |
| Molecular Weight | 213.63 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | (Z)-2-(chloromethyl)-1,1,1-trifluorohept-2-en-4-imine |
| SMILES | [H]/N=C(/C=C(\CCl)C(F)(F)F)CCC |
| InChI | InChI=1S/C8H11ClF3N/c1-2-3-7(13)4-6(5-9)8(10,11)12/h4,13H,2-3,5H2,1H3/b6-4+,13-7+ |
| InChIKey | HSNXPLCBMYNXSF-RYSUZZKOSA-N |
| XLogP | 3.53 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.63 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|