C8H13ClN2 — CID 90887194
6-chloro-4-methylhept-4-ene-2,3-diimine (PubChem CID 90887194) has the molecular formula C8H13ClN2 and a molecular weight of 172.66 g/mol. Its IUPAC name is 6-chloro-4-methylhept-4-ene-2,3-diimine.
| Compound Name | 6-chloro-4-methylhept-4-ene-2,3-diimine |
|---|---|
| PubChem CID | 90887194 |
| Molecular Formula | C8H13ClN2 |
| Molecular Weight | 172.66 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 6-chloro-4-methylhept-4-ene-2,3-diimine |
| SMILES | [H]/N=C(C(C)=CC(C)Cl)\C(C)=N\[H] |
| InChI | InChI=1S/C8H13ClN2/c1-5(4-6(2)9)8(11)7(3)10/h4,6,10-11H,1-3H3/b5-4?,10-7+,11-8- |
| InChIKey | DQDHYYMYVZHIPJ-NZXMKVBSSA-N |
| XLogP | 2.62 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.66 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|