C8H14N2 — CID 123609238
3-methylhept-3-ene-2,6-diimine (PubChem CID 123609238) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 3-methylhept-3-ene-2,6-diimine.
| Compound Name | 3-methylhept-3-ene-2,6-diimine |
|---|---|
| PubChem CID | 123609238 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 3-methylhept-3-ene-2,6-diimine |
| SMILES | [H]/N=C(\C)CC=C(C)/C(C)=N/[H] |
| InChI | InChI=1S/C8H14N2/c1-6(8(3)10)4-5-7(2)9/h4,9-10H,5H2,1-3H3/b6-4?,9-7+,10-8+ |
| InChIKey | MKKNTGHLEFUOTJ-LGXIXBKDSA-N |
| XLogP | 2.40 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|