C18H29F2N — CID 176922631
1-(1,1-difluoroethyl)-4-methylbenzene;ethane;(Z)-3-methylhex-3-en-2-imine (PubChem CID 176922631) has the molecular formula C18H29F2N and a molecular weight of 297.43 g/mol. Its IUPAC name is 1-(1,1-difluoroethyl)-4-methylbenzene;ethane;(Z)-3-methylhex-3-en-2-imine.
| Compound Name | 1-(1,1-difluoroethyl)-4-methylbenzene;ethane;(Z)-3-methylhex-3-en-2-imine |
|---|---|
| PubChem CID | 176922631 |
| Molecular Formula | C18H29F2N |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | 1-(1,1-difluoroethyl)-4-methylbenzene;ethane;(Z)-3-methylhex-3-en-2-imine |
| SMILES | CC.Cc1ccc(C(C)(F)F)cc1.[H]/N=C(C)/C(C)=C\CC |
| InChI | InChI=1S/C9H10F2.C7H13N.C2H6/c1-7-3-5-8(6-4-7)9(2,10)11;1-4-5-6(2)7(3)8;1-2/h3-6H,1-2H3;5,8H,4H2,1-3H3;1-2H3/b;6-5-,8-7+; |
| InChIKey | BUVVYAVOSAAZKC-WKIAGCFLSA-N |
| XLogP | 6.52 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|