About 1-(1,1-difluoroethyl)-4-methylbenzene;ethane;(Z)-3-methylhex-3-en-2-imine
1-(1,1-difluoroethyl)-4-methylbenzene;ethane;(Z)-3-methylhex-3-en-2-imine (PubChem CID 176922631) has the molecular formula C18H29F2N
and a molecular weight of 297.43 g/mol. Its IUPAC name is 1-(1,1-difluoroethyl)-4-methylbenzene;ethane;(Z)-3-methylhex-3-en-2-imine.
Molecular Properties
| Compound Name | 1-(1,1-difluoroethyl)-4-methylbenzene;ethane;(Z)-3-methylhex-3-en-2-imine |
| PubChem CID | 176922631 |
| Molecular Formula | C18H29F2N |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | 1-(1,1-difluoroethyl)-4-methylbenzene;ethane;(Z)-3-methylhex-3-en-2-imine |
| SMILES | CC.Cc1ccc(C(C)(F)F)cc1.[H]/N=C(C)/C(C)=C\CC |
| InChI | InChI=1S/C9H10F2.C7H13N.C2H6/c1-7-3-5-8(6-4-7)9(2,10)11;1-4-5-6(2)7(3)8;1-2/h3-6H,1-2H3;5,8H,4H2,1-3H3;1-2H3/b;6-5-,8-7+; |
| InChIKey | BUVVYAVOSAAZKC-WKIAGCFLSA-N |
| XLogP | 6.52 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,1-difluoroethyl)-4-methylbenzene;ethane;(Z)-3-methylhex-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-difluoroethyl)-4-methylbenzene;ethane;(Z)-3-methylhex-3-en-2-imine?
The IUPAC name of 1-(1,1-difluoroethyl)-4-methylbenzene;ethane;(Z)-3-methylhex-3-en-2-imine (CID 176922631) is 1-(1,1-difluoroethyl)-4-methylbenzene;ethane;(Z)-3-methylhex-3-en-2-imine.
What is the SMILES notation for 1-(1,1-difluoroethyl)-4-methylbenzene;ethane;(Z)-3-methylhex-3-en-2-imine?
The canonical SMILES for 1-(1,1-difluoroethyl)-4-methylbenzene;ethane;(Z)-3-methylhex-3-en-2-imine is CC.Cc1ccc(C(C)(F)F)cc1.[H]/N=C(C)/C(C)=C\CC.
What is the InChIKey of 1-(1,1-difluoroethyl)-4-methylbenzene;ethane;(Z)-3-methylhex-3-en-2-imine?
The InChIKey is BUVVYAVOSAAZKC-WKIAGCFLSA-N. The full InChI is InChI=1S/C9H10F2.C7H13N.C2H6/c1-7-3-5-8(6-4-7)9(2,10)11;1-4-5-6(2)7(3)8;1-2/h3-6H,1-2H3;5,8H,4H2,1-3H3;1-2H3/b;6-5-,8-7+;.
What are the key properties of 1-(1,1-difluoroethyl)-4-methylbenzene;ethane;(Z)-3-methylhex-3-en-2-imine?
1-(1,1-difluoroethyl)-4-methylbenzene;ethane;(Z)-3-methylhex-3-en-2-imine has a molecular weight of 297.43 g/mol, XLogP of 6.52, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-difluoroethyl)-4-methylbenzene;ethane;(Z)-3-methylhex-3-en-2-imine is sourced from PubChem (CID 176922631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).