About CID 176922266
CID 176922266 (PubChem CID 176922266) has the molecular formula C11H10BBrF2N2
and a molecular weight of 298.93 g/mol.
Molecular Properties
| Compound Name | CID 176922266 |
| PubChem CID | 176922266 |
| Molecular Formula | C11H10BBrF2N2 |
| Molecular Weight | 298.93 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | — |
| SMILES | [H]/N=C([B])/C=C(/Br)Nc1ccc(C(C)(F)F)cc1 |
| InChI | InChI=1S/C11H10BBrF2N2/c1-11(14,15)7-2-4-8(5-3-7)17-10(13)6-9(12)16/h2-6,16-17H,1H3/b10-6-,16-9- |
| InChIKey | LBAAOMHBQDTFQI-SACXNUKASA-N |
| XLogP | 3.59 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.93 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze CID 176922266 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176922266?
The IUPAC name of CID 176922266 (CID 176922266) is not available.
What is the SMILES notation for CID 176922266?
The canonical SMILES for CID 176922266 is [H]/N=C([B])/C=C(/Br)Nc1ccc(C(C)(F)F)cc1.
What is the InChIKey of CID 176922266?
The InChIKey is LBAAOMHBQDTFQI-SACXNUKASA-N. The full InChI is InChI=1S/C11H10BBrF2N2/c1-11(14,15)7-2-4-8(5-3-7)17-10(13)6-9(12)16/h2-6,16-17H,1H3/b10-6-,16-9-.
What are the key properties of CID 176922266?
CID 176922266 has a molecular weight of 298.93 g/mol, XLogP of 3.59, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176922266 is sourced from PubChem (CID 176922266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).