C11H10BBrF2N2 — CID 176922266
CID 176922266 (PubChem CID 176922266) has the molecular formula C11H10BBrF2N2 and a molecular weight of 298.93 g/mol.
| Compound Name | CID 176922266 |
|---|---|
| PubChem CID | 176922266 |
| Molecular Formula | C11H10BBrF2N2 |
| Molecular Weight | 298.93 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | — |
| SMILES | [H]/N=C([B])/C=C(/Br)Nc1ccc(C(C)(F)F)cc1 |
| InChI | InChI=1S/C11H10BBrF2N2/c1-11(14,15)7-2-4-8(5-3-7)17-10(13)6-9(12)16/h2-6,16-17H,1H3/b10-6-,16-9- |
| InChIKey | LBAAOMHBQDTFQI-SACXNUKASA-N |
| XLogP | 3.59 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.93 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|