C11H13F3O — CID 102471163
4,4,4-trifluoro-2-(4-methylphenyl)butan-2-ol (PubChem CID 102471163) has the molecular formula C11H13F3O and a molecular weight of 218.22 g/mol. Its IUPAC name is 4,4,4-trifluoro-2-(4-methylphenyl)butan-2-ol.
| Compound Name | 4,4,4-trifluoro-2-(4-methylphenyl)butan-2-ol |
|---|---|
| PubChem CID | 102471163 |
| Molecular Formula | C11H13F3O |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 4,4,4-trifluoro-2-(4-methylphenyl)butan-2-ol |
| SMILES | Cc1ccc(C(C)(O)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H13F3O/c1-8-3-5-9(6-4-8)10(2,15)7-11(12,13)14/h3-6,15H,7H2,1-2H3 |
| InChIKey | SHYBSWKTLZVQGK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |