C16H13F11O — CID 162347646
2-(4-methylphenyl)-1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)propan-2-ol (PubChem CID 162347646) has the molecular formula C16H13F11O and a molecular weight of 430.26 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)propan-2-ol.
| Compound Name | 2-(4-methylphenyl)-1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)propan-2-ol |
|---|---|
| PubChem CID | 162347646 |
| Molecular Formula | C16H13F11O |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 2-(4-methylphenyl)-1-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)propan-2-ol |
| SMILES | Cc1ccc(C(C)(O)CC2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)cc1 |
| InChI | InChI=1S/C16H13F11O/c1-8-3-5-9(6-4-8)10(2,28)7-11(17)12(18,19)14(22,23)16(26,27)15(24,25)13(11,20)21/h3-6,28H,7H2,1-2H3 |
| InChIKey | TYIIMFGLUYFINM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|