About 1-(1,1-difluoro-2,2-dimethylpropyl)-4-methylbenzene
1-(1,1-difluoro-2,2-dimethylpropyl)-4-methylbenzene (PubChem CID 22261761) has the molecular formula C12H16F2
and a molecular weight of 198.26 g/mol. Its IUPAC name is 1-(1,1-difluoro-2,2-dimethylpropyl)-4-methylbenzene.
Analyze 1-(1,1-difluoro-2,2-dimethylpropyl)-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-difluoro-2,2-dimethylpropyl)-4-methylbenzene?
The IUPAC name of 1-(1,1-difluoro-2,2-dimethylpropyl)-4-methylbenzene (CID 22261761) is 1-(1,1-difluoro-2,2-dimethylpropyl)-4-methylbenzene.
What is the SMILES notation for 1-(1,1-difluoro-2,2-dimethylpropyl)-4-methylbenzene?
The canonical SMILES for 1-(1,1-difluoro-2,2-dimethylpropyl)-4-methylbenzene is Cc1ccc(C(F)(F)C(C)(C)C)cc1.
What is the InChIKey of 1-(1,1-difluoro-2,2-dimethylpropyl)-4-methylbenzene?
The InChIKey is HDBALPKIHKCUKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2/c1-9-5-7-10(8-6-9)12(13,14)11(2,3)4/h5-8H,1-4H3.
What are the key properties of 1-(1,1-difluoro-2,2-dimethylpropyl)-4-methylbenzene?
1-(1,1-difluoro-2,2-dimethylpropyl)-4-methylbenzene has a molecular weight of 198.26 g/mol, XLogP of 4.13, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-difluoro-2,2-dimethylpropyl)-4-methylbenzene is sourced from PubChem (CID 22261761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).