About 1-methyl-4-[2,2,4-trifluoro-4-methyl-3-(4-methylphenyl)pentan-3-yl]benzene
1-methyl-4-[2,2,4-trifluoro-4-methyl-3-(4-methylphenyl)pentan-3-yl]benzene (PubChem CID 131994579) has the molecular formula C20H23F3
and a molecular weight of 320.40 g/mol. Its IUPAC name is 1-methyl-4-[2,2,4-trifluoro-4-methyl-3-(4-methylphenyl)pentan-3-yl]benzene.
Molecular Properties
| Compound Name | 1-methyl-4-[2,2,4-trifluoro-4-methyl-3-(4-methylphenyl)pentan-3-yl]benzene |
| PubChem CID | 131994579 |
| Molecular Formula | C20H23F3 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 1-methyl-4-[2,2,4-trifluoro-4-methyl-3-(4-methylphenyl)pentan-3-yl]benzene |
| SMILES | Cc1ccc(C(c2ccc(C)cc2)(C(C)(C)F)C(C)(F)F)cc1 |
| InChI | InChI=1S/C20H23F3/c1-14-6-10-16(11-7-14)20(18(3,4)21,19(5,22)23)17-12-8-15(2)9-13-17/h6-13H,1-5H3 |
| InChIKey | JMVXLSLNNCOBMQ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-methyl-4-[2,2,4-trifluoro-4-methyl-3-(4-methylphenyl)pentan-3-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[2,2,4-trifluoro-4-methyl-3-(4-methylphenyl)pentan-3-yl]benzene?
The IUPAC name of 1-methyl-4-[2,2,4-trifluoro-4-methyl-3-(4-methylphenyl)pentan-3-yl]benzene (CID 131994579) is 1-methyl-4-[2,2,4-trifluoro-4-methyl-3-(4-methylphenyl)pentan-3-yl]benzene.
What is the SMILES notation for 1-methyl-4-[2,2,4-trifluoro-4-methyl-3-(4-methylphenyl)pentan-3-yl]benzene?
The canonical SMILES for 1-methyl-4-[2,2,4-trifluoro-4-methyl-3-(4-methylphenyl)pentan-3-yl]benzene is Cc1ccc(C(c2ccc(C)cc2)(C(C)(C)F)C(C)(F)F)cc1.
What is the InChIKey of 1-methyl-4-[2,2,4-trifluoro-4-methyl-3-(4-methylphenyl)pentan-3-yl]benzene?
The InChIKey is JMVXLSLNNCOBMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23F3/c1-14-6-10-16(11-7-14)20(18(3,4)21,19(5,22)23)17-12-8-15(2)9-13-17/h6-13H,1-5H3.
What are the key properties of 1-methyl-4-[2,2,4-trifluoro-4-methyl-3-(4-methylphenyl)pentan-3-yl]benzene?
1-methyl-4-[2,2,4-trifluoro-4-methyl-3-(4-methylphenyl)pentan-3-yl]benzene has a molecular weight of 320.40 g/mol, XLogP of 5.99, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[2,2,4-trifluoro-4-methyl-3-(4-methylphenyl)pentan-3-yl]benzene is sourced from PubChem (CID 131994579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).