C9H14N2O2 — CID 91122217
3-[(E)-5-iminohex-2-en-2-yl]-1,3-oxazolidin-2-one (PubChem CID 91122217) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 3-[(E)-5-iminohex-2-en-2-yl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(E)-5-iminohex-2-en-2-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 91122217 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 3-[(E)-5-iminohex-2-en-2-yl]-1,3-oxazolidin-2-one |
| SMILES | [H]/N=C(\C)C/C=C(\C)N1CCOC1=O |
| InChI | InChI=1S/C9H14N2O2/c1-7(10)3-4-8(2)11-5-6-13-9(11)12/h4,10H,3,5-6H2,1-2H3/b8-4+,10-7+ |
| InChIKey | PWNLSOOMHMXDAU-AJQRHIRFSA-N |
| XLogP | 1.77 |
| TPSA | 53.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|