C22H28BN3O3 — CID 123821598
[8-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]-1,2,3,4-tetrahydroquinolin-5-yl]boronic acid (PubChem CID 123821598) has the molecular formula C22H28BN3O3 and a molecular weight of 393.30 g/mol. Its IUPAC name is [8-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]-1,2,3,4-tetrahydroquinolin-5-yl]boronic acid.
| Compound Name | [8-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]-1,2,3,4-tetrahydroquinolin-5-yl]boronic acid |
|---|---|
| PubChem CID | 123821598 |
| Molecular Formula | C22H28BN3O3 |
| Molecular Weight | 393.30 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | [8-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]-1,2,3,4-tetrahydroquinolin-5-yl]boronic acid |
| SMILES | NCc1cccc(C2CCN(C(=O)c3ccc(B(O)O)c4c3NCCC4)CC2)c1 |
| InChI | InChI=1S/C22H28BN3O3/c24-14-15-3-1-4-17(13-15)16-8-11-26(12-9-16)22(27)19-6-7-20(23(28)29)18-5-2-10-25-21(18)19/h1,3-4,6-7,13,16,25,28-29H,2,5,8-12,14,24H2 |
| InChIKey | FIWHTKCELKPVPI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|