C10H12F2O3 — CID 123821868
4-(difluoromethoxy)-3-ethoxycyclohexa-1,5-diene-1-carbaldehyde (PubChem CID 123821868) has the molecular formula C10H12F2O3 and a molecular weight of 218.20 g/mol. Its IUPAC name is 4-(difluoromethoxy)-3-ethoxycyclohexa-1,5-diene-1-carbaldehyde.
| Compound Name | 4-(difluoromethoxy)-3-ethoxycyclohexa-1,5-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 123821868 |
| Molecular Formula | C10H12F2O3 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 4-(difluoromethoxy)-3-ethoxycyclohexa-1,5-diene-1-carbaldehyde |
| SMILES | CCOC1C=C(C=O)C=CC1OC(F)F |
| InChI | InChI=1S/C10H12F2O3/c1-2-14-9-5-7(6-13)3-4-8(9)15-10(11)12/h3-6,8-10H,2H2,1H3 |
| InChIKey | YVXBBMRGTNRERT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|