C20H25F3O3 — CID 143222407
(E,2E)-4-methoxy-2-prop-2-enylidene-5-[(2E,7E)-9,9,9-trifluoro-2-methylnona-2,4,7-trienoxy]hex-3-enal (PubChem CID 143222407) has the molecular formula C20H25F3O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is (E,2E)-4-methoxy-2-prop-2-enylidene-5-[(2E,7E)-9,9,9-trifluoro-2-methylnona-2,4,7-trienoxy]hex-3-enal.
| Compound Name | (E,2E)-4-methoxy-2-prop-2-enylidene-5-[(2E,7E)-9,9,9-trifluoro-2-methylnona-2,4,7-trienoxy]hex-3-enal |
|---|---|
| PubChem CID | 143222407 |
| Molecular Formula | C20H25F3O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (E,2E)-4-methoxy-2-prop-2-enylidene-5-[(2E,7E)-9,9,9-trifluoro-2-methylnona-2,4,7-trienoxy]hex-3-enal |
| SMILES | C=C/C=C(C=O)\C=C(\OC)C(C)OC/C(C)=C/C=CC/C=C/C(F)(F)F |
| InChI | InChI=1S/C20H25F3O3/c1-5-10-18(14-24)13-19(25-4)17(3)26-15-16(2)11-8-6-7-9-12-20(21,22)23/h5-6,8-14,17H,1,7,15H2,2-4H3/b8-6?,12-9+,16-11+,18-10+,19-13+ |
| InChIKey | IACINDVJXAYHGU-KRIGKRKVSA-N |
| XLogP | 5.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|