C9H9F3O2 — CID 155598831
(2E,3Z)-2-ethylidene-5-(trifluoromethoxy)hexa-3,5-dienal (PubChem CID 155598831) has the molecular formula C9H9F3O2 and a molecular weight of 206.16 g/mol. Its IUPAC name is (2E,3Z)-2-ethylidene-5-(trifluoromethoxy)hexa-3,5-dienal.
| Compound Name | (2E,3Z)-2-ethylidene-5-(trifluoromethoxy)hexa-3,5-dienal |
|---|---|
| PubChem CID | 155598831 |
| Molecular Formula | C9H9F3O2 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | (2E,3Z)-2-ethylidene-5-(trifluoromethoxy)hexa-3,5-dienal |
| SMILES | C=C(/C=C\C(C=O)=C/C)OC(F)(F)F |
| InChI | InChI=1S/C9H9F3O2/c1-3-8(6-13)5-4-7(2)14-9(10,11)12/h3-6H,2H2,1H3/b5-4-,8-3+ |
| InChIKey | QJHZVGTULRXVNW-UEQFWHKLSA-N |
| XLogP | 2.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|