C20H28O3 — CID 145218767
(2Z,4E)-2-ethenyl-3-[(3Z,5E,7Z)-6-ethyl-5-methylnona-3,5,7-trien-2-yl]oxy-5-methoxypenta-2,4-dienal (PubChem CID 145218767) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (2Z,4E)-2-ethenyl-3-[(3Z,5E,7Z)-6-ethyl-5-methylnona-3,5,7-trien-2-yl]oxy-5-methoxypenta-2,4-dienal.
| Compound Name | (2Z,4E)-2-ethenyl-3-[(3Z,5E,7Z)-6-ethyl-5-methylnona-3,5,7-trien-2-yl]oxy-5-methoxypenta-2,4-dienal |
|---|---|
| PubChem CID | 145218767 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (2Z,4E)-2-ethenyl-3-[(3Z,5E,7Z)-6-ethyl-5-methylnona-3,5,7-trien-2-yl]oxy-5-methoxypenta-2,4-dienal |
| SMILES | C=C/C(C=O)=C(\C=C\OC)OC(C)/C=C\C(C)=C(\C=C/C)CC |
| InChI | InChI=1S/C20H28O3/c1-7-10-18(8-2)16(4)11-12-17(5)23-20(13-14-22-6)19(9-3)15-21/h7,9-15,17H,3,8H2,1-2,4-6H3/b10-7-,12-11-,14-13+,18-16+,20-19- |
| InChIKey | AJIPMMADXXMGTO-WAFYVGNHSA-N |
| XLogP | 5.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|