C18H28O3 — CID 12045876
ethyl (2E,4E,6E)-3-ethoxy-7,11-dimethyldodeca-2,4,6,10-tetraenoate (PubChem CID 12045876) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is ethyl (2E,4E,6E)-3-ethoxy-7,11-dimethyldodeca-2,4,6,10-tetraenoate.
| Compound Name | ethyl (2E,4E,6E)-3-ethoxy-7,11-dimethyldodeca-2,4,6,10-tetraenoate |
|---|---|
| PubChem CID | 12045876 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | ethyl (2E,4E,6E)-3-ethoxy-7,11-dimethyldodeca-2,4,6,10-tetraenoate |
| SMILES | CCOC(=O)/C=C(\C=C\C=C(/C)CCC=C(C)C)OCC |
| InChI | InChI=1S/C18H28O3/c1-6-20-17(14-18(19)21-7-2)13-9-12-16(5)11-8-10-15(3)4/h9-10,12-14H,6-8,11H2,1-5H3/b13-9+,16-12+,17-14+ |
| InChIKey | KDYXBKJUJLDYCR-DEZKWIKZSA-N |
| XLogP | 4.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|