C18H20F2O2 — CID 143713089
(3E,5E)-5-[[(1E,3Z,6Z)-cycloocta-1,3,6-trien-1-yl]methoxy]-4,7-difluoro-2-methylideneocta-3,5-dienal (PubChem CID 143713089) has the molecular formula C18H20F2O2 and a molecular weight of 306.35 g/mol. Its IUPAC name is (3E,5E)-5-[[(1E,3Z,6Z)-cycloocta-1,3,6-trien-1-yl]methoxy]-4,7-difluoro-2-methylideneocta-3,5-dienal.
| Compound Name | (3E,5E)-5-[[(1E,3Z,6Z)-cycloocta-1,3,6-trien-1-yl]methoxy]-4,7-difluoro-2-methylideneocta-3,5-dienal |
|---|---|
| PubChem CID | 143713089 |
| Molecular Formula | C18H20F2O2 |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (3E,5E)-5-[[(1E,3Z,6Z)-cycloocta-1,3,6-trien-1-yl]methoxy]-4,7-difluoro-2-methylideneocta-3,5-dienal |
| SMILES | C=C(C=O)/C=C(F)\C(=C/C(C)F)OC/C1=C/C=C\C/C=C\C1 |
| InChI | InChI=1S/C18H20F2O2/c1-14(12-21)10-17(20)18(11-15(2)19)22-13-16-8-6-4-3-5-7-9-16/h4-8,10-12,15H,1,3,9,13H2,2H3/b6-4-,7-5-,16-8+,17-10+,18-11+ |
| InChIKey | PHSAVSUMEVXKIH-IAKRYMRGSA-N |
| XLogP | 4.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|