C14H16O2 — CID 143285521
(3Z,7Z)-9-methoxy-2,5,6-trimethylidenedeca-3,7,9-trienal (PubChem CID 143285521) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (3Z,7Z)-9-methoxy-2,5,6-trimethylidenedeca-3,7,9-trienal.
| Compound Name | (3Z,7Z)-9-methoxy-2,5,6-trimethylidenedeca-3,7,9-trienal |
|---|---|
| PubChem CID | 143285521 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (3Z,7Z)-9-methoxy-2,5,6-trimethylidenedeca-3,7,9-trienal |
| SMILES | C=C(C=O)/C=C\C(=C)C(=C)/C=C\C(=C)OC |
| InChI | InChI=1S/C14H16O2/c1-11(10-15)6-7-12(2)13(3)8-9-14(4)16-5/h6-10H,1-4H2,5H3/b7-6-,9-8- |
| InChIKey | VGDXKUKZYPVMMB-JPDBVBESSA-N |
| XLogP | 3.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|