C11H18O2 — CID 15045773
(2E,6E)-8-methoxy-2,6-dimethylocta-2,6-dienal (PubChem CID 15045773) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (2E,6E)-8-methoxy-2,6-dimethylocta-2,6-dienal.
| Compound Name | (2E,6E)-8-methoxy-2,6-dimethylocta-2,6-dienal |
|---|---|
| PubChem CID | 15045773 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (2E,6E)-8-methoxy-2,6-dimethylocta-2,6-dienal |
| SMILES | COC/C=C(\C)CC/C=C(\C)C=O |
| InChI | InChI=1S/C11H18O2/c1-10(7-8-13-3)5-4-6-11(2)9-12/h6-7,9H,4-5,8H2,1-3H3/b10-7+,11-6+ |
| InChIKey | OTBCEAAHHCRUFU-NXAIOARDSA-N |
| XLogP | 2.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|