C29H43FO3 — CID 145121953
(4E,8E,12Z)-8-fluoro-4-(2-methoxyethoxy)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8,12-triene;2-methylprop-2-enal (PubChem CID 145121953) has the molecular formula C29H43FO3 and a molecular weight of 458.66 g/mol. Its IUPAC name is (4E,8E,12Z)-8-fluoro-4-(2-methoxyethoxy)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8,12-triene;2-methylprop-2-enal.
| Compound Name | (4E,8E,12Z)-8-fluoro-4-(2-methoxyethoxy)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8,12-triene;2-methylprop-2-enal |
|---|---|
| PubChem CID | 145121953 |
| Molecular Formula | C29H43FO3 |
| Molecular Weight | 458.66 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | (4E,8E,12Z)-8-fluoro-4-(2-methoxyethoxy)-11,14-dimethyl-3,6,7,10-tetramethylidenehexadeca-4,8,12-triene;2-methylprop-2-enal |
| SMILES | C=C(/C=C(/OCCOC)C(=C)CC)C(=C)/C(F)=C/C(=C)C(C)/C=C\C(C)CC.C=C(C)C=O |
| InChI | InChI=1S/C25H37FO2.C4H6O/c1-10-18(3)12-13-20(5)21(6)16-24(26)23(8)22(7)17-25(19(4)11-2)28-15-14-27-9;1-4(2)3-5/h12-13,16-18,20H,4,6-8,10-11,14-15H2,1-3,5,9H3;3H,1H2,2H3/b13-12-,24-16+,25-17+; |
| InChIKey | UQIGADCMFFXURC-XFTQHHIZSA-N |
| XLogP | 8.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.66 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|