C24H38O3 — CID 145122126
acetaldehyde;(3Z,7E)-8-(2-methoxyethoxy)-2,4-dimethyl-5,6,9-trimethylideneundeca-1,3,7-triene;prop-1-ene (PubChem CID 145122126) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is acetaldehyde;(3Z,7E)-8-(2-methoxyethoxy)-2,4-dimethyl-5,6,9-trimethylideneundeca-1,3,7-triene;prop-1-ene.
| Compound Name | acetaldehyde;(3Z,7E)-8-(2-methoxyethoxy)-2,4-dimethyl-5,6,9-trimethylideneundeca-1,3,7-triene;prop-1-ene |
|---|---|
| PubChem CID | 145122126 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | acetaldehyde;(3Z,7E)-8-(2-methoxyethoxy)-2,4-dimethyl-5,6,9-trimethylideneundeca-1,3,7-triene;prop-1-ene |
| SMILES | C=C(C)/C=C(/C)C(=C)C(=C)/C=C(\OCCOC)C(=C)CC.C=CC.CC=O |
| InChI | InChI=1S/C19H28O2.C3H6.C2H4O/c1-9-15(4)19(21-11-10-20-8)13-17(6)18(7)16(5)12-14(2)3;1-3-2;1-2-3/h12-13H,2,4,6-7,9-11H2,1,3,5,8H3;3H,1H2,2H3;2H,1H3/b16-12-,19-13+;; |
| InChIKey | IZPACYBHXQFBIY-HSGOLYAZSA-N |
| XLogP | 6.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|