C20H28O3 — CID 143384193
(3E,5E)-5-[(2E,4Z)-2,5-dimethyl-6-methylideneocta-2,4-dienoxy]-4-methoxyocta-3,5,7-trienal (PubChem CID 143384193) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (3E,5E)-5-[(2E,4Z)-2,5-dimethyl-6-methylideneocta-2,4-dienoxy]-4-methoxyocta-3,5,7-trienal.
| Compound Name | (3E,5E)-5-[(2E,4Z)-2,5-dimethyl-6-methylideneocta-2,4-dienoxy]-4-methoxyocta-3,5,7-trienal |
|---|---|
| PubChem CID | 143384193 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (3E,5E)-5-[(2E,4Z)-2,5-dimethyl-6-methylideneocta-2,4-dienoxy]-4-methoxyocta-3,5,7-trienal |
| SMILES | C=C/C=C(OC/C(C)=C/C=C(/C)C(=C)CC)\C(=C/CC=O)OC |
| InChI | InChI=1S/C20H28O3/c1-7-10-20(19(22-6)11-9-14-21)23-15-16(3)12-13-18(5)17(4)8-2/h7,10-14H,1,4,8-9,15H2,2-3,5-6H3/b16-12+,18-13-,19-11+,20-10+ |
| InChIKey | GCQOWCKTMQIMGX-JWEWSYBASA-N |
| XLogP | 5.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|