C18H24O2 — CID 123946540
3-(2,4-dimethylcyclohexa-2,4-dien-1-yl)oxy-4-ethylideneocta-2,5-dienal (PubChem CID 123946540) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 3-(2,4-dimethylcyclohexa-2,4-dien-1-yl)oxy-4-ethylideneocta-2,5-dienal.
| Compound Name | 3-(2,4-dimethylcyclohexa-2,4-dien-1-yl)oxy-4-ethylideneocta-2,5-dienal |
|---|---|
| PubChem CID | 123946540 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 3-(2,4-dimethylcyclohexa-2,4-dien-1-yl)oxy-4-ethylideneocta-2,5-dienal |
| SMILES | CC=C(C=CCC)C(=CC=O)OC1CC=C(C)C=C1C |
| InChI | InChI=1S/C18H24O2/c1-5-7-8-16(6-2)18(11-12-19)20-17-10-9-14(3)13-15(17)4/h6-9,11-13,17H,5,10H2,1-4H3 |
| InChIKey | NAZRVAUMDZFFQN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|