C12H22O2 — CID 143791077
ethane;2-(2-methoxyethoxy)-1-methylcyclohexa-1,3-diene (PubChem CID 143791077) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is ethane;2-(2-methoxyethoxy)-1-methylcyclohexa-1,3-diene.
| Compound Name | ethane;2-(2-methoxyethoxy)-1-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143791077 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | ethane;2-(2-methoxyethoxy)-1-methylcyclohexa-1,3-diene |
| SMILES | CC.COCCOC1=C(C)CCC=C1 |
| InChI | InChI=1S/C10H16O2.C2H6/c1-9-5-3-4-6-10(9)12-8-7-11-2;1-2/h4,6H,3,5,7-8H2,1-2H3;1-2H3 |
| InChIKey | JOUWRIZGKVFDFP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|