C14H24O2 — CID 143010385
ethane;5-[(Z)-2-ethenylpent-1-enyl]-6-methyl-2,3-dihydro-1,4-dioxine (PubChem CID 143010385) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is ethane;5-[(Z)-2-ethenylpent-1-enyl]-6-methyl-2,3-dihydro-1,4-dioxine.
| Compound Name | ethane;5-[(Z)-2-ethenylpent-1-enyl]-6-methyl-2,3-dihydro-1,4-dioxine |
|---|---|
| PubChem CID | 143010385 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | ethane;5-[(Z)-2-ethenylpent-1-enyl]-6-methyl-2,3-dihydro-1,4-dioxine |
| SMILES | C=C/C(=C\C1=C(C)OCCO1)CCC.CC |
| InChI | InChI=1S/C12H18O2.C2H6/c1-4-6-11(5-2)9-12-10(3)13-7-8-14-12;1-2/h5,9H,2,4,6-8H2,1,3H3;1-2H3/b11-9+; |
| InChIKey | MVZAZJJXIWQSIF-LBEJWNQZSA-N |
| XLogP | 4.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|