C10H16O2 — CID 143791078
2-(2-methoxyethoxy)-1-methylcyclohexa-1,3-diene (PubChem CID 143791078) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-1-methylcyclohexa-1,3-diene.
| Compound Name | 2-(2-methoxyethoxy)-1-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143791078 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 2-(2-methoxyethoxy)-1-methylcyclohexa-1,3-diene |
| SMILES | COCCOC1=C(C)CCC=C1 |
| InChI | InChI=1S/C10H16O2/c1-9-5-3-4-6-10(9)12-8-7-11-2/h4,6H,3,5,7-8H2,1-2H3 |
| InChIKey | SXENRPNXYIASNC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|