C30H44O2 — CID 145122124
acetaldehyde;(3Z,7Z,11Z)-12-but-1-en-2-yl-2-methoxy-8,14-dimethyl-5,6,9,10-tetramethylidenepentadeca-1,3,7,11,14-pentaene;ethane (PubChem CID 145122124) has the molecular formula C30H44O2 and a molecular weight of 436.68 g/mol. Its IUPAC name is acetaldehyde;(3Z,7Z,11Z)-12-but-1-en-2-yl-2-methoxy-8,14-dimethyl-5,6,9,10-tetramethylidenepentadeca-1,3,7,11,14-pentaene;ethane.
| Compound Name | acetaldehyde;(3Z,7Z,11Z)-12-but-1-en-2-yl-2-methoxy-8,14-dimethyl-5,6,9,10-tetramethylidenepentadeca-1,3,7,11,14-pentaene;ethane |
|---|---|
| PubChem CID | 145122124 |
| Molecular Formula | C30H44O2 |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | acetaldehyde;(3Z,7Z,11Z)-12-but-1-en-2-yl-2-methoxy-8,14-dimethyl-5,6,9,10-tetramethylidenepentadeca-1,3,7,11,14-pentaene;ethane |
| SMILES | C=C(C)C/C(=C/C(=C)C(=C)/C(C)=C/C(=C)C(=C)/C=C\C(=C)OC)C(=C)CC.CC.CC=O |
| InChI | InChI=1S/C26H34O.C2H4O.C2H6/c1-12-19(4)26(15-18(2)3)17-23(8)25(10)22(7)16-21(6)20(5)13-14-24(9)27-11;1-2-3;1-2/h13-14,16-17H,2,4-6,8-10,12,15H2,1,3,7,11H3;2H,1H3;1-2H3/b14-13-,22-16-,26-17-;; |
| InChIKey | UMHHETDTWPTGNB-OADKHALJSA-N |
| XLogP | 8.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|